| Identification | Back Directory | [Name]
5-bromo-4-cyclopropyl-6-methoxypyrimidine(WX192148) | [CAS]
1649454-57-8 | [Synonyms]
5-bromo-4-cyclopropyl-6-methoxypyrimidine
WX192148,5-bromo-4-cyclopropyl-6-methoxypyrimidine
5-bromo-4-cyclopropyl-6-methoxypyrimidine(WX192148) | [Molecular Formula]
C8H9BrN2O | [MDL Number]
MFCD31556944 | [MOL File]
1649454-57-8.mol | [Molecular Weight]
229.07 |
| Chemical Properties | Back Directory | [Boiling point ]
289.3±40.0 °C(Predicted) | [density ]
1.590±0.06 g/cm3(Predicted) | [pka]
2.13±0.28(Predicted) | [InChI]
InChI=1S/C8H9BrN2O/c1-12-8-6(9)7(5-2-3-5)10-4-11-8/h4-5H,2-3H2,1H3 | [InChIKey]
FHEYKQYHQQAZBJ-UHFFFAOYSA-N | [SMILES]
C1=NC(OC)=C(Br)C(C2CC2)=N1 |
| Hazard Information | Back Directory | [Synthesis]
To a solution of 4-cyclopropyl-6-methoxypyrimidine (1.6 g, 10.7 mmol) in EtOH (10 mL) was added Bn (1.87 g, 11.7 mmol) at -20 °C. The resulting mixture was slowly warmed to room temperature and stirred at the same temperature for 16 h. Solvent was removed under reduced pressure and the residue dissolved in EtOAc and washed with saturated Na2C03, water and brine. The organic layer was dried over Na2SO4 and concentrated to give 5-bromo-4-cyclopropyl-6-methoxypyrimidine (2.3 g).
 |
|
| Company Name: |
Gold
|
| Tel: |
18595278766 18595278766 |
| Website: |
www.mayowell.com/ |
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Tel: |
0573-85285100 18627885956 |
| Website: |
//bestpetlove.com/ShowSupplierProductsList14265/0.htm |
| Company Name: |
|
| Tel: |
21-58226973 18917146209 |
| Website: |
//www.novapharmas.com |
| Company Name: |
|
| Tel: |
021-65232103 17602124823 |
| Website: |
//www.combiphos.com |
| Company Name: |
|
| Tel: |
022-59987777 13552403979 |
| Website: |
www.labnetwork.com |
| Company Name: |
|
| Tel: |
025-58859352 18068836627 |
| Website: |
//www.aikonchem.com |
| Company Name: |
|
| Tel: |
021-61469567 18521078705 |
| Website: |
www.fdc-chemical.com/ |
| Company Name: |
|
| Tel: |
0512-0512-69561983 13914027025 |
| Website: |
//www.medinoah.com/ |
|